About 6-methyl-6-(1-methylpyrrolidin-3-yl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1,2-diamine
6-methyl-6-(1-methylpyrrolidin-3-yl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1,2-diamine (PubChem CID 142776473) has the molecular formula C13H20F3N3
and a molecular weight of 275.32 g/mol. Its IUPAC name is 6-methyl-6-(1-methylpyrrolidin-3-yl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1,2-diamine.
Molecular Properties
| Compound Name | 6-methyl-6-(1-methylpyrrolidin-3-yl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1,2-diamine |
| PubChem CID | 142776473 |
| Molecular Formula | C13H20F3N3 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 6-methyl-6-(1-methylpyrrolidin-3-yl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1,2-diamine |
| SMILES | CN1CCC(C2(C)C(C(F)(F)F)=CC=C(N)C2N)C1 |
| InChI | InChI=1S/C13H20F3N3/c1-12(8-5-6-19(2)7-8)10(13(14,15)16)4-3-9(17)11(12)18/h3-4,8,11H,5-7,17-18H2,1-2H3 |
| InChIKey | ZNLMOKFPSLPOQS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-6-(1-methylpyrrolidin-3-yl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-6-(1-methylpyrrolidin-3-yl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1,2-diamine?
The IUPAC name of 6-methyl-6-(1-methylpyrrolidin-3-yl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1,2-diamine (CID 142776473) is 6-methyl-6-(1-methylpyrrolidin-3-yl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1,2-diamine.
What is the SMILES notation for 6-methyl-6-(1-methylpyrrolidin-3-yl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1,2-diamine?
The canonical SMILES for 6-methyl-6-(1-methylpyrrolidin-3-yl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1,2-diamine is CN1CCC(C2(C)C(C(F)(F)F)=CC=C(N)C2N)C1.
What is the InChIKey of 6-methyl-6-(1-methylpyrrolidin-3-yl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1,2-diamine?
The InChIKey is ZNLMOKFPSLPOQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F3N3/c1-12(8-5-6-19(2)7-8)10(13(14,15)16)4-3-9(17)11(12)18/h3-4,8,11H,5-7,17-18H2,1-2H3.
What are the key properties of 6-methyl-6-(1-methylpyrrolidin-3-yl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1,2-diamine?
6-methyl-6-(1-methylpyrrolidin-3-yl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1,2-diamine has a molecular weight of 275.32 g/mol, XLogP of 1.62, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-6-(1-methylpyrrolidin-3-yl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1,2-diamine is sourced from PubChem (CID 142776473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).