C31H27N7O2 — CID 142777344
2-[3-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]amino]phenyl]-N',N'-dimethylbenzohydrazide (PubChem CID 142777344) has the molecular formula C31H27N7O2 and a molecular weight of 529.60 g/mol. Its IUPAC name is 2-[3-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]amino]phenyl]-N',N'-dimethylbenzohydrazide.
| Compound Name | 2-[3-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]amino]phenyl]-N',N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 142777344 |
| Molecular Formula | C31H27N7O2 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | 2-[3-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]amino]phenyl]-N',N'-dimethylbenzohydrazide |
| SMILES | COc1ccc(-c2nnc3c4ccccc4c(Nc4cccc(-c5ccccc5C(=O)NN(C)C)c4)nn23)cc1 |
| InChI | InChI=1S/C31H27N7O2/c1-37(2)36-31(39)27-14-7-4-11-24(27)21-9-8-10-22(19-21)32-28-25-12-5-6-13-26(25)30-34-33-29(38(30)35-28)20-15-17-23(40-3)18-16-20/h4-19H,1-3H3,(H,32,35)(H,36,39) |
| InChIKey | BHOGUXWQJHZVRP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|