About 3-chloro-1-fluoropyrrole
3-chloro-1-fluoropyrrole (PubChem CID 142777485) has the molecular formula C4H3ClFN
and a molecular weight of 119.53 g/mol. Its IUPAC name is 3-chloro-1-fluoropyrrole.
Molecular Properties
| Compound Name | 3-chloro-1-fluoropyrrole |
| PubChem CID | 142777485 |
| Molecular Formula | C4H3ClFN |
| Molecular Weight | 119.53 g/mol |
| Exact Mass | 118.99 |
| IUPAC Name | 3-chloro-1-fluoropyrrole |
| SMILES | Fn1ccc(Cl)c1 |
| InChI | InChI=1S/C4H3ClFN/c5-4-1-2-7(6)3-4/h1-3H |
| InChIKey | WIPAJMPRAMEHGB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.53 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-1-fluoropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1-fluoropyrrole?
The IUPAC name of 3-chloro-1-fluoropyrrole (CID 142777485) is 3-chloro-1-fluoropyrrole.
What is the SMILES notation for 3-chloro-1-fluoropyrrole?
The canonical SMILES for 3-chloro-1-fluoropyrrole is Fn1ccc(Cl)c1.
What is the InChIKey of 3-chloro-1-fluoropyrrole?
The InChIKey is WIPAJMPRAMEHGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3ClFN/c5-4-1-2-7(6)3-4/h1-3H.
What are the key properties of 3-chloro-1-fluoropyrrole?
3-chloro-1-fluoropyrrole has a molecular weight of 119.53 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1-fluoropyrrole is sourced from PubChem (CID 142777485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).