C38H58O4S2 — CID 142777582
ethyl 3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-ethoxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]prop-2-enoate (PubChem CID 142777582) has the molecular formula C38H58O4S2 and a molecular weight of 643.01 g/mol. Its IUPAC name is ethyl 3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-ethoxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]prop-2-enoate.
| Compound Name | ethyl 3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-ethoxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]prop-2-enoate |
|---|---|
| PubChem CID | 142777582 |
| Molecular Formula | C38H58O4S2 |
| Molecular Weight | 643.01 g/mol |
| Exact Mass | 642.38 |
| IUPAC Name | ethyl 3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-ethoxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]prop-2-enoate |
| SMILES | CCOC(=O)C=COc1c(C(C)(C)C)cc(SC(C)(C)Sc2cc(C(C)(C)C)c(OCC)c(C(C)(C)C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C38H58O4S2/c1-17-40-31(39)19-20-42-33-29(36(9,10)11)23-26(24-30(33)37(12,13)14)44-38(15,16)43-25-21-27(34(3,4)5)32(41-18-2)28(22-25)35(6,7)8/h19-24H,17-18H2,1-16H3 |
| InChIKey | GYABMTTVCAOSOJ-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.01 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|