C22H27NO4 — CID 14277777
[6-pyridin-3-yl-6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl] acetate (PubChem CID 14277777) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is [6-pyridin-3-yl-6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl] acetate.
| Compound Name | [6-pyridin-3-yl-6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl] acetate |
|---|---|
| PubChem CID | 14277777 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [6-pyridin-3-yl-6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl] acetate |
| SMILES | CC(=O)OCCCCCC(C1=C(C)C(=O)C(C)=C(C)C1=O)c1cccnc1 |
| InChI | InChI=1S/C22H27NO4/c1-14-15(2)22(26)20(16(3)21(14)25)19(18-9-8-11-23-13-18)10-6-5-7-12-27-17(4)24/h8-9,11,13,19H,5-7,10,12H2,1-4H3 |
| InChIKey | LGDPNFPYQFDOKS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|