C26H21ClN2O2 — CID 14277848
1-benzyl-2-(2-chlorophenyl)-6-methyl-4-oxo-N-phenylpyridine-3-carboxamide (PubChem CID 14277848) has the molecular formula C26H21ClN2O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is 1-benzyl-2-(2-chlorophenyl)-6-methyl-4-oxo-N-phenylpyridine-3-carboxamide.
| Compound Name | 1-benzyl-2-(2-chlorophenyl)-6-methyl-4-oxo-N-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 14277848 |
| Molecular Formula | C26H21ClN2O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 1-benzyl-2-(2-chlorophenyl)-6-methyl-4-oxo-N-phenylpyridine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2ccccc2)c(-c2ccccc2Cl)n1Cc1ccccc1 |
| InChI | InChI=1S/C26H21ClN2O2/c1-18-16-23(30)24(26(31)28-20-12-6-3-7-13-20)25(21-14-8-9-15-22(21)27)29(18)17-19-10-4-2-5-11-19/h2-16H,17H2,1H3,(H,28,31) |
| InChIKey | NVRYJPBLDYSALE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |