About (5-methoxy-5-methyl-6-propan-2-yloxycyclohexa-1,3-dien-1-yl)methanamine
(5-methoxy-5-methyl-6-propan-2-yloxycyclohexa-1,3-dien-1-yl)methanamine (PubChem CID 142779373) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is (5-methoxy-5-methyl-6-propan-2-yloxycyclohexa-1,3-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | (5-methoxy-5-methyl-6-propan-2-yloxycyclohexa-1,3-dien-1-yl)methanamine |
| PubChem CID | 142779373 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (5-methoxy-5-methyl-6-propan-2-yloxycyclohexa-1,3-dien-1-yl)methanamine |
| SMILES | COC1(C)C=CC=C(CN)C1OC(C)C |
| InChI | InChI=1S/C12H21NO2/c1-9(2)15-11-10(8-13)6-5-7-12(11,3)14-4/h5-7,9,11H,8,13H2,1-4H3 |
| InChIKey | OTVNGQXITBVXKD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-methoxy-5-methyl-6-propan-2-yloxycyclohexa-1,3-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methoxy-5-methyl-6-propan-2-yloxycyclohexa-1,3-dien-1-yl)methanamine?
The IUPAC name of (5-methoxy-5-methyl-6-propan-2-yloxycyclohexa-1,3-dien-1-yl)methanamine (CID 142779373) is (5-methoxy-5-methyl-6-propan-2-yloxycyclohexa-1,3-dien-1-yl)methanamine.
What is the SMILES notation for (5-methoxy-5-methyl-6-propan-2-yloxycyclohexa-1,3-dien-1-yl)methanamine?
The canonical SMILES for (5-methoxy-5-methyl-6-propan-2-yloxycyclohexa-1,3-dien-1-yl)methanamine is COC1(C)C=CC=C(CN)C1OC(C)C.
What is the InChIKey of (5-methoxy-5-methyl-6-propan-2-yloxycyclohexa-1,3-dien-1-yl)methanamine?
The InChIKey is OTVNGQXITBVXKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2/c1-9(2)15-11-10(8-13)6-5-7-12(11,3)14-4/h5-7,9,11H,8,13H2,1-4H3.
What are the key properties of (5-methoxy-5-methyl-6-propan-2-yloxycyclohexa-1,3-dien-1-yl)methanamine?
(5-methoxy-5-methyl-6-propan-2-yloxycyclohexa-1,3-dien-1-yl)methanamine has a molecular weight of 211.30 g/mol, XLogP of 1.64, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methoxy-5-methyl-6-propan-2-yloxycyclohexa-1,3-dien-1-yl)methanamine is sourced from PubChem (CID 142779373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).