About (4a-methyl-3,5-dihydro-2H-1,4-benzodioxin-6-yl)methanamine
(4a-methyl-3,5-dihydro-2H-1,4-benzodioxin-6-yl)methanamine (PubChem CID 142779375) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is (4a-methyl-3,5-dihydro-2H-1,4-benzodioxin-6-yl)methanamine.
Molecular Properties
| Compound Name | (4a-methyl-3,5-dihydro-2H-1,4-benzodioxin-6-yl)methanamine |
| PubChem CID | 142779375 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (4a-methyl-3,5-dihydro-2H-1,4-benzodioxin-6-yl)methanamine |
| SMILES | CC12CC(CN)=CC=C1OCCO2 |
| InChI | InChI=1S/C10H15NO2/c1-10-6-8(7-11)2-3-9(10)12-4-5-13-10/h2-3H,4-7,11H2,1H3 |
| InChIKey | BWBHDHHYMMZUPM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4a-methyl-3,5-dihydro-2H-1,4-benzodioxin-6-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4a-methyl-3,5-dihydro-2H-1,4-benzodioxin-6-yl)methanamine?
The IUPAC name of (4a-methyl-3,5-dihydro-2H-1,4-benzodioxin-6-yl)methanamine (CID 142779375) is (4a-methyl-3,5-dihydro-2H-1,4-benzodioxin-6-yl)methanamine.
What is the SMILES notation for (4a-methyl-3,5-dihydro-2H-1,4-benzodioxin-6-yl)methanamine?
The canonical SMILES for (4a-methyl-3,5-dihydro-2H-1,4-benzodioxin-6-yl)methanamine is CC12CC(CN)=CC=C1OCCO2.
What is the InChIKey of (4a-methyl-3,5-dihydro-2H-1,4-benzodioxin-6-yl)methanamine?
The InChIKey is BWBHDHHYMMZUPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-10-6-8(7-11)2-3-9(10)12-4-5-13-10/h2-3H,4-7,11H2,1H3.
What are the key properties of (4a-methyl-3,5-dihydro-2H-1,4-benzodioxin-6-yl)methanamine?
(4a-methyl-3,5-dihydro-2H-1,4-benzodioxin-6-yl)methanamine has a molecular weight of 181.23 g/mol, XLogP of 0.96, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4a-methyl-3,5-dihydro-2H-1,4-benzodioxin-6-yl)methanamine is sourced from PubChem (CID 142779375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).