C17H24F3N5 — CID 142779735
N-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-2,5,6,7-tetrahydro-1H-1,4-diazepin-2-amine (PubChem CID 142779735) has the molecular formula C17H24F3N5 and a molecular weight of 355.41 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-2,5,6,7-tetrahydro-1H-1,4-diazepin-2-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-2,5,6,7-tetrahydro-1H-1,4-diazepin-2-amine |
|---|---|
| PubChem CID | 142779735 |
| Molecular Formula | C17H24F3N5 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-2,5,6,7-tetrahydro-1H-1,4-diazepin-2-amine |
| SMILES | CN1CCN(c2ccc(NC3C=NCCCN3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H24F3N5/c1-24-7-9-25(10-8-24)15-4-3-13(11-14(15)17(18,19)20)23-16-12-21-5-2-6-22-16/h3-4,11-12,16,22-23H,2,5-10H2,1H3 |
| InChIKey | HVXUVWNGZYWCMG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|