C12H20N2S — CID 142779965
3-(ethylaminomethyl)-4-propan-2-ylsulfanylaniline (PubChem CID 142779965) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 3-(ethylaminomethyl)-4-propan-2-ylsulfanylaniline.
| Compound Name | 3-(ethylaminomethyl)-4-propan-2-ylsulfanylaniline |
|---|---|
| PubChem CID | 142779965 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-(ethylaminomethyl)-4-propan-2-ylsulfanylaniline |
| SMILES | CCNCc1cc(N)ccc1SC(C)C |
| InChI | InChI=1S/C12H20N2S/c1-4-14-8-10-7-11(13)5-6-12(10)15-9(2)3/h5-7,9,14H,4,8,13H2,1-3H3 |
| InChIKey | ARJMAIREEKTQAV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|