About 3-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1-(4-propan-2-ylphenyl)sulfonylindol-5-ol
3-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1-(4-propan-2-ylphenyl)sulfonylindol-5-ol (PubChem CID 142780064) has the molecular formula C25H33N3O3S
and a molecular weight of 455.62 g/mol. Its IUPAC name is 3-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1-(4-propan-2-ylphenyl)sulfonylindol-5-ol.
Molecular Properties
| Compound Name | 3-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1-(4-propan-2-ylphenyl)sulfonylindol-5-ol |
| PubChem CID | 142780064 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 3-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1-(4-propan-2-ylphenyl)sulfonylindol-5-ol |
| SMILES | CCN1CCCN(Cc2cn(S(=O)(=O)c3ccc(C(C)C)cc3)c3ccc(O)cc23)CC1 |
| InChI | InChI=1S/C25H33N3O3S/c1-4-26-12-5-13-27(15-14-26)17-21-18-28(25-11-8-22(29)16-24(21)25)32(30,31)23-9-6-20(7-10-23)19(2)3/h6-11,16,18-19,29H,4-5,12-15,17H2,1-3H3 |
| InChIKey | BKRNROSJQQSTKB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1-(4-propan-2-ylphenyl)sulfonylindol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1-(4-propan-2-ylphenyl)sulfonylindol-5-ol?
The IUPAC name of 3-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1-(4-propan-2-ylphenyl)sulfonylindol-5-ol (CID 142780064) is 3-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1-(4-propan-2-ylphenyl)sulfonylindol-5-ol.
What is the SMILES notation for 3-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1-(4-propan-2-ylphenyl)sulfonylindol-5-ol?
The canonical SMILES for 3-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1-(4-propan-2-ylphenyl)sulfonylindol-5-ol is CCN1CCCN(Cc2cn(S(=O)(=O)c3ccc(C(C)C)cc3)c3ccc(O)cc23)CC1.
What is the InChIKey of 3-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1-(4-propan-2-ylphenyl)sulfonylindol-5-ol?
The InChIKey is BKRNROSJQQSTKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H33N3O3S/c1-4-26-12-5-13-27(15-14-26)17-21-18-28(25-11-8-22(29)16-24(21)25)32(30,31)23-9-6-20(7-10-23)19(2)3/h6-11,16,18-19,29H,4-5,12-15,17H2,1-3H3.
What are the key properties of 3-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1-(4-propan-2-ylphenyl)sulfonylindol-5-ol?
3-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1-(4-propan-2-ylphenyl)sulfonylindol-5-ol has a molecular weight of 455.62 g/mol, XLogP of 4.23, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-ethyl-1,4-diazepan-1-yl)methyl]-1-(4-propan-2-ylphenyl)sulfonylindol-5-ol is sourced from PubChem (CID 142780064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).