About 3-[4-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]imidazol-1-yl]butanoic acid
3-[4-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]imidazol-1-yl]butanoic acid (PubChem CID 142780612) has the molecular formula C20H24F2N4O4
and a molecular weight of 422.43 g/mol. Its IUPAC name is 3-[4-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]imidazol-1-yl]butanoic acid.
Molecular Properties
| Compound Name | 3-[4-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]imidazol-1-yl]butanoic acid |
| PubChem CID | 142780612 |
| Molecular Formula | C20H24F2N4O4 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 3-[4-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]imidazol-1-yl]butanoic acid |
| SMILES | CCCC(NC(=O)Cc1cc(F)cc(F)c1)C(=O)Nc1cn(C(C)CC(=O)O)cn1 |
| InChI | InChI=1S/C20H24F2N4O4/c1-3-4-16(24-18(27)8-13-6-14(21)9-15(22)7-13)20(30)25-17-10-26(11-23-17)12(2)5-19(28)29/h6-7,9-12,16H,3-5,8H2,1-2H3,(H,24,27)(H,25,30)(H,28,29) |
| InChIKey | BYEDVBNQSUDZIS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]imidazol-1-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]imidazol-1-yl]butanoic acid?
The IUPAC name of 3-[4-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]imidazol-1-yl]butanoic acid (CID 142780612) is 3-[4-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]imidazol-1-yl]butanoic acid.
What is the SMILES notation for 3-[4-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]imidazol-1-yl]butanoic acid?
The canonical SMILES for 3-[4-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]imidazol-1-yl]butanoic acid is CCCC(NC(=O)Cc1cc(F)cc(F)c1)C(=O)Nc1cn(C(C)CC(=O)O)cn1.
What is the InChIKey of 3-[4-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]imidazol-1-yl]butanoic acid?
The InChIKey is BYEDVBNQSUDZIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24F2N4O4/c1-3-4-16(24-18(27)8-13-6-14(21)9-15(22)7-13)20(30)25-17-10-26(11-23-17)12(2)5-19(28)29/h6-7,9-12,16H,3-5,8H2,1-2H3,(H,24,27)(H,25,30)(H,28,29).
What are the key properties of 3-[4-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]imidazol-1-yl]butanoic acid?
3-[4-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]imidazol-1-yl]butanoic acid has a molecular weight of 422.43 g/mol, XLogP of 2.66, 10 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]imidazol-1-yl]butanoic acid is sourced from PubChem (CID 142780612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).