C10H13ClS — CID 142780867
(2Z,4Z,6Z,8Z)-1-chloro-1-ethylthionine (PubChem CID 142780867) has the molecular formula C10H13ClS and a molecular weight of 200.73 g/mol. Its IUPAC name is (2Z,4Z,6Z,8Z)-1-chloro-1-ethylthionine.
| Compound Name | (2Z,4Z,6Z,8Z)-1-chloro-1-ethylthionine |
|---|---|
| PubChem CID | 142780867 |
| Molecular Formula | C10H13ClS |
| Molecular Weight | 200.73 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | (2Z,4Z,6Z,8Z)-1-chloro-1-ethylthionine |
| SMILES | CCS1(Cl)/C=C\C=C/C=C\C=C/1 |
| InChI | InChI=1S/C10H13ClS/c1-2-12(11)9-7-5-3-4-6-8-10-12/h3-10H,2H2,1H3/b5-3-,6-4-,9-7-,10-8- |
| InChIKey | HRHFKJSSOBZFHC-RSIYVSQUSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.73 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |