C23H25FN2O5S — CID 142781520
2-amino-4-(3-fluorophenyl)-2-[[4-(4-methoxyphenyl)piperidin-1-yl]sulfonylmethyl]but-3-ynoic acid (PubChem CID 142781520) has the molecular formula C23H25FN2O5S and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-amino-4-(3-fluorophenyl)-2-[[4-(4-methoxyphenyl)piperidin-1-yl]sulfonylmethyl]but-3-ynoic acid.
| Compound Name | 2-amino-4-(3-fluorophenyl)-2-[[4-(4-methoxyphenyl)piperidin-1-yl]sulfonylmethyl]but-3-ynoic acid |
|---|---|
| PubChem CID | 142781520 |
| Molecular Formula | C23H25FN2O5S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 2-amino-4-(3-fluorophenyl)-2-[[4-(4-methoxyphenyl)piperidin-1-yl]sulfonylmethyl]but-3-ynoic acid |
| SMILES | COc1ccc(C2CCN(S(=O)(=O)CC(N)(C#Cc3cccc(F)c3)C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C23H25FN2O5S/c1-31-21-7-5-18(6-8-21)19-10-13-26(14-11-19)32(29,30)16-23(25,22(27)28)12-9-17-3-2-4-20(24)15-17/h2-8,15,19H,10-11,13-14,16,25H2,1H3,(H,27,28) |
| InChIKey | GZVQOMRVCLJQGG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|