C11H11F3N2O — CID 142782271
2-[4-(3,4-dihydropyrazol-2-yl)-2,3,5-trifluorophenyl]ethanol (PubChem CID 142782271) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 2-[4-(3,4-dihydropyrazol-2-yl)-2,3,5-trifluorophenyl]ethanol.
| Compound Name | 2-[4-(3,4-dihydropyrazol-2-yl)-2,3,5-trifluorophenyl]ethanol |
|---|---|
| PubChem CID | 142782271 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-[4-(3,4-dihydropyrazol-2-yl)-2,3,5-trifluorophenyl]ethanol |
| SMILES | OCCc1cc(F)c(N2CCC=N2)c(F)c1F |
| InChI | InChI=1S/C11H11F3N2O/c12-8-6-7(2-5-17)9(13)10(14)11(8)16-4-1-3-15-16/h3,6,17H,1-2,4-5H2 |
| InChIKey | MSYRIHBWELHTHW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|