C10H11ClF2N2O3 — CID 142783024
6-[chloro(difluoro)methyl]-1-(2-methoxyethyl)-2-oxopyridine-3-carboxamide (PubChem CID 142783024) has the molecular formula C10H11ClF2N2O3 and a molecular weight of 280.66 g/mol. Its IUPAC name is 6-[chloro(difluoro)methyl]-1-(2-methoxyethyl)-2-oxopyridine-3-carboxamide.
| Compound Name | 6-[chloro(difluoro)methyl]-1-(2-methoxyethyl)-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 142783024 |
| Molecular Formula | C10H11ClF2N2O3 |
| Molecular Weight | 280.66 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 6-[chloro(difluoro)methyl]-1-(2-methoxyethyl)-2-oxopyridine-3-carboxamide |
| SMILES | COCCn1c(C(F)(F)Cl)ccc(C(N)=O)c1=O |
| InChI | InChI=1S/C10H11ClF2N2O3/c1-18-5-4-15-7(10(11,12)13)3-2-6(8(14)16)9(15)17/h2-3H,4-5H2,1H3,(H2,14,16) |
| InChIKey | GVPCVVPJSUXSLW-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.66 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|