About 6-amino-1-tert-butylcyclohexa-2,4-diene-1-sulfonamide
6-amino-1-tert-butylcyclohexa-2,4-diene-1-sulfonamide (PubChem CID 142784463) has the molecular formula C10H18N2O2S
and a molecular weight of 230.33 g/mol. Its IUPAC name is 6-amino-1-tert-butylcyclohexa-2,4-diene-1-sulfonamide.
Molecular Properties
| Compound Name | 6-amino-1-tert-butylcyclohexa-2,4-diene-1-sulfonamide |
| PubChem CID | 142784463 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 6-amino-1-tert-butylcyclohexa-2,4-diene-1-sulfonamide |
| SMILES | CC(C)(C)C1(S(N)(=O)=O)C=CC=CC1N |
| InChI | InChI=1S/C10H18N2O2S/c1-9(2,3)10(15(12,13)14)7-5-4-6-8(10)11/h4-8H,11H2,1-3H3,(H2,12,13,14) |
| InChIKey | QEIWCIIYCONBEX-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-1-tert-butylcyclohexa-2,4-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1-tert-butylcyclohexa-2,4-diene-1-sulfonamide?
The IUPAC name of 6-amino-1-tert-butylcyclohexa-2,4-diene-1-sulfonamide (CID 142784463) is 6-amino-1-tert-butylcyclohexa-2,4-diene-1-sulfonamide.
What is the SMILES notation for 6-amino-1-tert-butylcyclohexa-2,4-diene-1-sulfonamide?
The canonical SMILES for 6-amino-1-tert-butylcyclohexa-2,4-diene-1-sulfonamide is CC(C)(C)C1(S(N)(=O)=O)C=CC=CC1N.
What is the InChIKey of 6-amino-1-tert-butylcyclohexa-2,4-diene-1-sulfonamide?
The InChIKey is QEIWCIIYCONBEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2S/c1-9(2,3)10(15(12,13)14)7-5-4-6-8(10)11/h4-8H,11H2,1-3H3,(H2,12,13,14).
What are the key properties of 6-amino-1-tert-butylcyclohexa-2,4-diene-1-sulfonamide?
6-amino-1-tert-butylcyclohexa-2,4-diene-1-sulfonamide has a molecular weight of 230.33 g/mol, XLogP of 0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1-tert-butylcyclohexa-2,4-diene-1-sulfonamide is sourced from PubChem (CID 142784463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).