About 4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]-2-fluorobenzoic acid
4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]-2-fluorobenzoic acid (PubChem CID 142784841) has the molecular formula C24H24Cl2FNO3
and a molecular weight of 464.36 g/mol. Its IUPAC name is 4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]-2-fluorobenzoic acid.
Molecular Properties
| Compound Name | 4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]-2-fluorobenzoic acid |
| PubChem CID | 142784841 |
| Molecular Formula | C24H24Cl2FNO3 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(-c2cc(Cl)c(CC3CCN(C4CCCCC4)C3=O)c(Cl)c2)cc1F |
| InChI | InChI=1S/C24H24Cl2FNO3/c25-20-11-16(14-6-7-18(24(30)31)22(27)13-14)12-21(26)19(20)10-15-8-9-28(23(15)29)17-4-2-1-3-5-17/h6-7,11-13,15,17H,1-5,8-10H2,(H,30,31) |
| InChIKey | LRMHETOVCFJSLD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]-2-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]-2-fluorobenzoic acid?
The IUPAC name of 4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]-2-fluorobenzoic acid (CID 142784841) is 4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]-2-fluorobenzoic acid.
What is the SMILES notation for 4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]-2-fluorobenzoic acid?
The canonical SMILES for 4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]-2-fluorobenzoic acid is O=C(O)c1ccc(-c2cc(Cl)c(CC3CCN(C4CCCCC4)C3=O)c(Cl)c2)cc1F.
What is the InChIKey of 4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]-2-fluorobenzoic acid?
The InChIKey is LRMHETOVCFJSLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24Cl2FNO3/c25-20-11-16(14-6-7-18(24(30)31)22(27)13-14)12-21(26)19(20)10-15-8-9-28(23(15)29)17-4-2-1-3-5-17/h6-7,11-13,15,17H,1-5,8-10H2,(H,30,31).
What are the key properties of 4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]-2-fluorobenzoic acid?
4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]-2-fluorobenzoic acid has a molecular weight of 464.36 g/mol, XLogP of 6.22, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]-2-fluorobenzoic acid is sourced from PubChem (CID 142784841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).