C12H20N2 — CID 142784985
2-(3,3,4-trimethylcyclohexa-1,5-dien-1-yl)propanimidamide (PubChem CID 142784985) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-(3,3,4-trimethylcyclohexa-1,5-dien-1-yl)propanimidamide.
| Compound Name | 2-(3,3,4-trimethylcyclohexa-1,5-dien-1-yl)propanimidamide |
|---|---|
| PubChem CID | 142784985 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-(3,3,4-trimethylcyclohexa-1,5-dien-1-yl)propanimidamide |
| SMILES | [H]/N=C(\N)C(C)C1=CC(C)(C)C(C)C=C1 |
| InChI | InChI=1S/C12H20N2/c1-8-5-6-10(7-12(8,3)4)9(2)11(13)14/h5-9H,1-4H3,(H3,13,14) |
| InChIKey | GRRIHWLQBLTHIL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|