C27H29BrN4O3 — CID 142785681
(10R,15S)-4-bromo-13-[3-(but-3-enylamino)propyl]-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione (PubChem CID 142785681) has the molecular formula C27H29BrN4O3 and a molecular weight of 537.46 g/mol. Its IUPAC name is (10R,15S)-4-bromo-13-[3-(but-3-enylamino)propyl]-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione.
| Compound Name | (10R,15S)-4-bromo-13-[3-(but-3-enylamino)propyl]-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
|---|---|
| PubChem CID | 142785681 |
| Molecular Formula | C27H29BrN4O3 |
| Molecular Weight | 537.46 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | (10R,15S)-4-bromo-13-[3-(but-3-enylamino)propyl]-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
| SMILES | C=CCCNCCCN1C(=O)N2[C@H](c3cccc(O)c3)c3[nH]c4ccc(Br)cc4c3C[C@@]2(C)C1=O |
| InChI | InChI=1S/C27H29BrN4O3/c1-3-4-11-29-12-6-13-31-25(34)27(2)16-21-20-15-18(28)9-10-22(20)30-23(21)24(32(27)26(31)35)17-7-5-8-19(33)14-17/h3,5,7-10,14-15,24,29-30,33H,1,4,6,11-13,16H2,2H3/t24-,27+/m1/s1 |
| InChIKey | ICAMPXCDKYYTEB-SQHAQQRYSA-N |
| XLogP | 4.86 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|