C20H18F4N2O3 — CID 142785973
2-[4-ethyl-6-fluoro-7-methyl-2-(2,2,2-trifluoroethyl)-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione (PubChem CID 142785973) has the molecular formula C20H18F4N2O3 and a molecular weight of 410.37 g/mol. Its IUPAC name is 2-[4-ethyl-6-fluoro-7-methyl-2-(2,2,2-trifluoroethyl)-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione.
| Compound Name | 2-[4-ethyl-6-fluoro-7-methyl-2-(2,2,2-trifluoroethyl)-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 142785973 |
| Molecular Formula | C20H18F4N2O3 |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-[4-ethyl-6-fluoro-7-methyl-2-(2,2,2-trifluoroethyl)-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione |
| SMILES | CCc1c(C(=O)C2C(=O)CCCC2=O)c(CC(F)(F)F)nc2nc(C)c(F)cc12 |
| InChI | InChI=1S/C20H18F4N2O3/c1-3-10-11-7-12(21)9(2)25-19(11)26-13(8-20(22,23)24)16(10)18(29)17-14(27)5-4-6-15(17)28/h7,17H,3-6,8H2,1-2H3 |
| InChIKey | UUXSDPXDUBNHAP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 76.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|