C17H17N3O4S — CID 142786091
5-[3-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]phenyl]pent-4-enoic acid (PubChem CID 142786091) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is 5-[3-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]phenyl]pent-4-enoic acid.
| Compound Name | 5-[3-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]phenyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 142786091 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 5-[3-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]phenyl]pent-4-enoic acid |
| SMILES | NC(=O)Nc1sc(-c2cccc(C=CCCC(=O)O)c2)cc1C(N)=O |
| InChI | InChI=1S/C17H17N3O4S/c18-15(23)12-9-13(25-16(12)20-17(19)24)11-6-3-5-10(8-11)4-1-2-7-14(21)22/h1,3-6,8-9H,2,7H2,(H2,18,23)(H,21,22)(H3,19,20,24) |
| InChIKey | ZWNKVEIPVLHBET-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |