C22H23NO2S — CID 142786247
N-(2-phenylphenyl)-1-(2,4,6-trimethylphenyl)methanesulfonamide (PubChem CID 142786247) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-(2-phenylphenyl)-1-(2,4,6-trimethylphenyl)methanesulfonamide.
| Compound Name | N-(2-phenylphenyl)-1-(2,4,6-trimethylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 142786247 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-(2-phenylphenyl)-1-(2,4,6-trimethylphenyl)methanesulfonamide |
| SMILES | Cc1cc(C)c(CS(=O)(=O)Nc2ccccc2-c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C22H23NO2S/c1-16-13-17(2)21(18(3)14-16)15-26(24,25)23-22-12-8-7-11-20(22)19-9-5-4-6-10-19/h4-14,23H,15H2,1-3H3 |
| InChIKey | NSQVZLNCPKINJQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |