About propanoyl piperidine-1-carboxylate
propanoyl piperidine-1-carboxylate (PubChem CID 142786690) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is propanoyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | propanoyl piperidine-1-carboxylate |
| PubChem CID | 142786690 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | propanoyl piperidine-1-carboxylate |
| SMILES | CCC(=O)OC(=O)N1CCCCC1 |
| InChI | InChI=1S/C9H15NO3/c1-2-8(11)13-9(12)10-6-4-3-5-7-10/h2-7H2,1H3 |
| InChIKey | AOKBGIKVXQJRCB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze propanoyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoyl piperidine-1-carboxylate?
The IUPAC name of propanoyl piperidine-1-carboxylate (CID 142786690) is propanoyl piperidine-1-carboxylate.
What is the SMILES notation for propanoyl piperidine-1-carboxylate?
The canonical SMILES for propanoyl piperidine-1-carboxylate is CCC(=O)OC(=O)N1CCCCC1.
What is the InChIKey of propanoyl piperidine-1-carboxylate?
The InChIKey is AOKBGIKVXQJRCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-2-8(11)13-9(12)10-6-4-3-5-7-10/h2-7H2,1H3.
What are the key properties of propanoyl piperidine-1-carboxylate?
propanoyl piperidine-1-carboxylate has a molecular weight of 185.22 g/mol, XLogP of 1.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propanoyl piperidine-1-carboxylate is sourced from PubChem (CID 142786690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).