C23H21F3N2O — CID 142787059
1-[4-methyl-3-[4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4-tetrahydroisoquinolin-5-amine (PubChem CID 142787059) has the molecular formula C23H21F3N2O and a molecular weight of 398.43 g/mol. Its IUPAC name is 1-[4-methyl-3-[4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4-tetrahydroisoquinolin-5-amine.
| Compound Name | 1-[4-methyl-3-[4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4-tetrahydroisoquinolin-5-amine |
|---|---|
| PubChem CID | 142787059 |
| Molecular Formula | C23H21F3N2O |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 1-[4-methyl-3-[4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4-tetrahydroisoquinolin-5-amine |
| SMILES | Cc1ccc(C2NCCc3c(N)cccc32)cc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H21F3N2O/c1-14-5-6-16(22-19-3-2-4-21(27)18(19)11-12-28-22)13-20(14)15-7-9-17(10-8-15)29-23(24,25)26/h2-10,13,22,28H,11-12,27H2,1H3 |
| InChIKey | MBSLIXFKMOJXJH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|