C15H18F3N3O5 — CID 142787475
4-[1-(dimethylcarbamoylamino)-2-[(2,2,2-trifluoroacetyl)amino]propoxy]benzoic acid (PubChem CID 142787475) has the molecular formula C15H18F3N3O5 and a molecular weight of 377.32 g/mol. Its IUPAC name is 4-[1-(dimethylcarbamoylamino)-2-[(2,2,2-trifluoroacetyl)amino]propoxy]benzoic acid.
| Compound Name | 4-[1-(dimethylcarbamoylamino)-2-[(2,2,2-trifluoroacetyl)amino]propoxy]benzoic acid |
|---|---|
| PubChem CID | 142787475 |
| Molecular Formula | C15H18F3N3O5 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 4-[1-(dimethylcarbamoylamino)-2-[(2,2,2-trifluoroacetyl)amino]propoxy]benzoic acid |
| SMILES | CC(NC(=O)C(F)(F)F)C(NC(=O)N(C)C)Oc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H18F3N3O5/c1-8(19-13(24)15(16,17)18)11(20-14(25)21(2)3)26-10-6-4-9(5-7-10)12(22)23/h4-8,11H,1-3H3,(H,19,24)(H,20,25)(H,22,23) |
| InChIKey | DZNNEAKQZQJLBJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|