C21H24ClN3O2S — CID 142787528
5-butyl-6-chloro-5-[5-(4-methoxy-3-methylphenyl)-1,3,4-thiadiazol-2-yl]cyclohexa-1,3-diene-1-carboxamide (PubChem CID 142787528) has the molecular formula C21H24ClN3O2S and a molecular weight of 417.96 g/mol. Its IUPAC name is 5-butyl-6-chloro-5-[5-(4-methoxy-3-methylphenyl)-1,3,4-thiadiazol-2-yl]cyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 5-butyl-6-chloro-5-[5-(4-methoxy-3-methylphenyl)-1,3,4-thiadiazol-2-yl]cyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 142787528 |
| Molecular Formula | C21H24ClN3O2S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 5-butyl-6-chloro-5-[5-(4-methoxy-3-methylphenyl)-1,3,4-thiadiazol-2-yl]cyclohexa-1,3-diene-1-carboxamide |
| SMILES | CCCCC1(c2nnc(-c3ccc(OC)c(C)c3)s2)C=CC=C(C(N)=O)C1Cl |
| InChI | InChI=1S/C21H24ClN3O2S/c1-4-5-10-21(11-6-7-15(17(21)22)18(23)26)20-25-24-19(28-20)14-8-9-16(27-3)13(2)12-14/h6-9,11-12,17H,4-5,10H2,1-3H3,(H2,23,26) |
| InChIKey | ALQBYDUYZZZXSF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|