C20H18FN3O3S — CID 142787530
4-[5-[(3-butyl-2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]benzoic acid (PubChem CID 142787530) has the molecular formula C20H18FN3O3S and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-[5-[(3-butyl-2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]benzoic acid.
| Compound Name | 4-[5-[(3-butyl-2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 142787530 |
| Molecular Formula | C20H18FN3O3S |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 4-[5-[(3-butyl-2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]benzoic acid |
| SMILES | CCCCc1cccc(C(=O)Nc2nnc(-c3ccc(C(=O)O)cc3)s2)c1F |
| InChI | InChI=1S/C20H18FN3O3S/c1-2-3-5-12-6-4-7-15(16(12)21)17(25)22-20-24-23-18(28-20)13-8-10-14(11-9-13)19(26)27/h4,6-11H,2-3,5H2,1H3,(H,26,27)(H,22,24,25) |
| InChIKey | JAMFMIYWCRHBBB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |