C22H26ClN3O2S — CID 142787543
5-butyl-6-chloro-5-[5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]cyclohexa-1,3-diene-1-carboxamide (PubChem CID 142787543) has the molecular formula C22H26ClN3O2S and a molecular weight of 431.99 g/mol. Its IUPAC name is 5-butyl-6-chloro-5-[5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]cyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 5-butyl-6-chloro-5-[5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]cyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 142787543 |
| Molecular Formula | C22H26ClN3O2S |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 5-butyl-6-chloro-5-[5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]cyclohexa-1,3-diene-1-carboxamide |
| SMILES | CCCCC1(c2nnc(-c3cc(C)c(OC)c(C)c3)s2)C=CC=C(C(N)=O)C1Cl |
| InChI | InChI=1S/C22H26ClN3O2S/c1-5-6-9-22(10-7-8-16(18(22)23)19(24)27)21-26-25-20(29-21)15-11-13(2)17(28-4)14(3)12-15/h7-8,10-12,18H,5-6,9H2,1-4H3,(H2,24,27) |
| InChIKey | ICUVTDAQVCRXEU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|