C21H22FN3O2S — CID 142787546
N-fluoro-3-[5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]-2-propylbenzamide (PubChem CID 142787546) has the molecular formula C21H22FN3O2S and a molecular weight of 399.49 g/mol. Its IUPAC name is N-fluoro-3-[5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]-2-propylbenzamide.
| Compound Name | N-fluoro-3-[5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]-2-propylbenzamide |
|---|---|
| PubChem CID | 142787546 |
| Molecular Formula | C21H22FN3O2S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-fluoro-3-[5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]-2-propylbenzamide |
| SMILES | CCCc1c(C(=O)NF)cccc1-c1nnc(-c2cc(C)c(OC)c(C)c2)s1 |
| InChI | InChI=1S/C21H22FN3O2S/c1-5-7-15-16(19(26)23-22)8-6-9-17(15)21-25-24-20(28-21)14-10-12(2)18(27-4)13(3)11-14/h6,8-11H,5,7H2,1-4H3,(H,23,26) |
| InChIKey | UQFYJOPJURKLAP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|