C22H25Cl2N3O2S — CID 142787556
5-butyl-2,6-dichloro-5-[5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]cyclohexa-1,3-diene-1-carboxamide (PubChem CID 142787556) has the molecular formula C22H25Cl2N3O2S and a molecular weight of 466.43 g/mol. Its IUPAC name is 5-butyl-2,6-dichloro-5-[5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]cyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 5-butyl-2,6-dichloro-5-[5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]cyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 142787556 |
| Molecular Formula | C22H25Cl2N3O2S |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 5-butyl-2,6-dichloro-5-[5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]cyclohexa-1,3-diene-1-carboxamide |
| SMILES | CCCCC1(c2nnc(-c3cc(C)c(OC)c(C)c3)s2)C=CC(Cl)=C(C(N)=O)C1Cl |
| InChI | InChI=1S/C22H25Cl2N3O2S/c1-5-6-8-22(9-7-15(23)16(18(22)24)19(25)28)21-27-26-20(30-21)14-10-12(2)17(29-4)13(3)11-14/h7,9-11,18H,5-6,8H2,1-4H3,(H2,25,28) |
| InChIKey | NUTPEMMHGNIFCF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|