About 2-chloro-3-[4-[(1,3-thiazol-2-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide
2-chloro-3-[4-[(1,3-thiazol-2-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide (PubChem CID 142787879) has the molecular formula C18H19ClF3N3OS
and a molecular weight of 417.88 g/mol. Its IUPAC name is 2-chloro-3-[4-[(1,3-thiazol-2-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | 2-chloro-3-[4-[(1,3-thiazol-2-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide |
| PubChem CID | 142787879 |
| Molecular Formula | C18H19ClF3N3OS |
| Molecular Weight | 417.88 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-chloro-3-[4-[(1,3-thiazol-2-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide |
| SMILES | NC(=O)c1cc(C(F)(F)F)cc(C2CCC(CNc3nccs3)CC2)c1Cl |
| InChI | InChI=1S/C18H19ClF3N3OS/c19-15-13(7-12(18(20,21)22)8-14(15)16(23)26)11-3-1-10(2-4-11)9-25-17-24-5-6-27-17/h5-8,10-11H,1-4,9H2,(H2,23,26)(H,24,25) |
| InChIKey | MAUFEIABSOTLSQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.88 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-3-[4-[(1,3-thiazol-2-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-[4-[(1,3-thiazol-2-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide?
The IUPAC name of 2-chloro-3-[4-[(1,3-thiazol-2-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide (CID 142787879) is 2-chloro-3-[4-[(1,3-thiazol-2-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide.
What is the SMILES notation for 2-chloro-3-[4-[(1,3-thiazol-2-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide?
The canonical SMILES for 2-chloro-3-[4-[(1,3-thiazol-2-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide is NC(=O)c1cc(C(F)(F)F)cc(C2CCC(CNc3nccs3)CC2)c1Cl.
What is the InChIKey of 2-chloro-3-[4-[(1,3-thiazol-2-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide?
The InChIKey is MAUFEIABSOTLSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClF3N3OS/c19-15-13(7-12(18(20,21)22)8-14(15)16(23)26)11-3-1-10(2-4-11)9-25-17-24-5-6-27-17/h5-8,10-11H,1-4,9H2,(H2,23,26)(H,24,25).
What are the key properties of 2-chloro-3-[4-[(1,3-thiazol-2-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide?
2-chloro-3-[4-[(1,3-thiazol-2-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide has a molecular weight of 417.88 g/mol, XLogP of 5.30, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-[4-[(1,3-thiazol-2-ylamino)methyl]cyclohexyl]-5-(trifluoromethyl)benzamide is sourced from PubChem (CID 142787879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).