C14H16F3N5S — CID 14278793
2-butyl-1-[5-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine (PubChem CID 14278793) has the molecular formula C14H16F3N5S and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-butyl-1-[5-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine.
| Compound Name | 2-butyl-1-[5-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 14278793 |
| Molecular Formula | C14H16F3N5S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-butyl-1-[5-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]guanidine |
| SMILES | CCCC/N=C(\N)Nc1nnc(-c2ccccc2C(F)(F)F)s1 |
| InChI | InChI=1S/C14H16F3N5S/c1-2-3-8-19-12(18)20-13-22-21-11(23-13)9-6-4-5-7-10(9)14(15,16)17/h4-7H,2-3,8H2,1H3,(H3,18,19,20,22) |
| InChIKey | DWPVNDJMKOGRIQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|