About [2-(cyanomethyl)phenyl] N'-methylcarbamimidothioate;hydrochloride
[2-(cyanomethyl)phenyl] N'-methylcarbamimidothioate;hydrochloride (PubChem CID 142789243) has the molecular formula C10H12ClN3S
and a molecular weight of 241.75 g/mol. Its IUPAC name is [2-(cyanomethyl)phenyl] N'-methylcarbamimidothioate;hydrochloride.
Molecular Properties
| Compound Name | [2-(cyanomethyl)phenyl] N'-methylcarbamimidothioate;hydrochloride |
| PubChem CID | 142789243 |
| Molecular Formula | C10H12ClN3S |
| Molecular Weight | 241.75 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | [2-(cyanomethyl)phenyl] N'-methylcarbamimidothioate;hydrochloride |
| SMILES | C/N=C(\N)Sc1ccccc1CC#N.Cl |
| InChI | InChI=1S/C10H11N3S.ClH/c1-13-10(12)14-9-5-3-2-4-8(9)6-7-11;/h2-5H,6H2,1H3,(H2,12,13);1H |
| InChIKey | WLMZTSJKTBPUFC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.75 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [2-(cyanomethyl)phenyl] N'-methylcarbamimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(cyanomethyl)phenyl] N'-methylcarbamimidothioate;hydrochloride?
The IUPAC name of [2-(cyanomethyl)phenyl] N'-methylcarbamimidothioate;hydrochloride (CID 142789243) is [2-(cyanomethyl)phenyl] N'-methylcarbamimidothioate;hydrochloride.
What is the SMILES notation for [2-(cyanomethyl)phenyl] N'-methylcarbamimidothioate;hydrochloride?
The canonical SMILES for [2-(cyanomethyl)phenyl] N'-methylcarbamimidothioate;hydrochloride is C/N=C(\N)Sc1ccccc1CC#N.Cl.
What is the InChIKey of [2-(cyanomethyl)phenyl] N'-methylcarbamimidothioate;hydrochloride?
The InChIKey is WLMZTSJKTBPUFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3S.ClH/c1-13-10(12)14-9-5-3-2-4-8(9)6-7-11;/h2-5H,6H2,1H3,(H2,12,13);1H.
What are the key properties of [2-(cyanomethyl)phenyl] N'-methylcarbamimidothioate;hydrochloride?
[2-(cyanomethyl)phenyl] N'-methylcarbamimidothioate;hydrochloride has a molecular weight of 241.75 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(cyanomethyl)phenyl] N'-methylcarbamimidothioate;hydrochloride is sourced from PubChem (CID 142789243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).