About 2-(4-chloro-3-fluorophenyl)-7-(4-methylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-amine
2-(4-chloro-3-fluorophenyl)-7-(4-methylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-amine (PubChem CID 142789476) has the molecular formula C19H18ClFN4
and a molecular weight of 356.83 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-7-(4-methylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-amine.
Molecular Properties
| Compound Name | 2-(4-chloro-3-fluorophenyl)-7-(4-methylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-amine |
| PubChem CID | 142789476 |
| Molecular Formula | C19H18ClFN4 |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-7-(4-methylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-amine |
| SMILES | Cc1ccc(N2CCn3c(nc(-c4ccc(Cl)c(F)c4)c3N)C2)cc1 |
| InChI | InChI=1S/C19H18ClFN4/c1-12-2-5-14(6-3-12)24-8-9-25-17(11-24)23-18(19(25)22)13-4-7-15(20)16(21)10-13/h2-7,10H,8-9,11,22H2,1H3 |
| InChIKey | LWDCHIRTBMGKJT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloro-3-fluorophenyl)-7-(4-methylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-3-fluorophenyl)-7-(4-methylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-amine?
The IUPAC name of 2-(4-chloro-3-fluorophenyl)-7-(4-methylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-amine (CID 142789476) is 2-(4-chloro-3-fluorophenyl)-7-(4-methylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-amine.
What is the SMILES notation for 2-(4-chloro-3-fluorophenyl)-7-(4-methylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-amine?
The canonical SMILES for 2-(4-chloro-3-fluorophenyl)-7-(4-methylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-amine is Cc1ccc(N2CCn3c(nc(-c4ccc(Cl)c(F)c4)c3N)C2)cc1.
What is the InChIKey of 2-(4-chloro-3-fluorophenyl)-7-(4-methylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-amine?
The InChIKey is LWDCHIRTBMGKJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClFN4/c1-12-2-5-14(6-3-12)24-8-9-25-17(11-24)23-18(19(25)22)13-4-7-15(20)16(21)10-13/h2-7,10H,8-9,11,22H2,1H3.
What are the key properties of 2-(4-chloro-3-fluorophenyl)-7-(4-methylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-amine?
2-(4-chloro-3-fluorophenyl)-7-(4-methylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-amine has a molecular weight of 356.83 g/mol, XLogP of 4.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-3-fluorophenyl)-7-(4-methylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-amine is sourced from PubChem (CID 142789476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).