C22H25ClN6 — CID 142791258
12-chloro-3-[4-(4,6-dimethylpyrimidin-2-yl)cyclohexyl]-4,5,8,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaene (PubChem CID 142791258) has the molecular formula C22H25ClN6 and a molecular weight of 408.94 g/mol. Its IUPAC name is 12-chloro-3-[4-(4,6-dimethylpyrimidin-2-yl)cyclohexyl]-4,5,8,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaene.
| Compound Name | 12-chloro-3-[4-(4,6-dimethylpyrimidin-2-yl)cyclohexyl]-4,5,8,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaene |
|---|---|
| PubChem CID | 142791258 |
| Molecular Formula | C22H25ClN6 |
| Molecular Weight | 408.94 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 12-chloro-3-[4-(4,6-dimethylpyrimidin-2-yl)cyclohexyl]-4,5,8,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaene |
| SMILES | Cc1cc(C)nc(C2CCC(c3n[nH]c4c3-c3ncc(Cl)cc3CNC4)CC2)n1 |
| InChI | InChI=1S/C22H25ClN6/c1-12-7-13(2)27-22(26-12)15-5-3-14(4-6-15)21-19-18(28-29-21)11-24-9-16-8-17(23)10-25-20(16)19/h7-8,10,14-15,24H,3-6,9,11H2,1-2H3,(H,28,29) |
| InChIKey | FTSVFRQXRRPGJP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.94 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |