About 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynyl N-tert-butylcarbamate
3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynyl N-tert-butylcarbamate (PubChem CID 142791381) has the molecular formula C13H17ClN4O2
and a molecular weight of 296.76 g/mol. Its IUPAC name is 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynyl N-tert-butylcarbamate.
Molecular Properties
| Compound Name | 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynyl N-tert-butylcarbamate |
| PubChem CID | 142791381 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynyl N-tert-butylcarbamate |
| SMILES | Cc1nc(N)nc(Cl)c1C#CCOC(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H17ClN4O2/c1-8-9(10(14)17-11(15)16-8)6-5-7-20-12(19)18-13(2,3)4/h7H2,1-4H3,(H,18,19)(H2,15,16,17) |
| InChIKey | VMMXYKVXJHEAGS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynyl N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynyl N-tert-butylcarbamate?
The IUPAC name of 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynyl N-tert-butylcarbamate (CID 142791381) is 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynyl N-tert-butylcarbamate.
What is the SMILES notation for 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynyl N-tert-butylcarbamate?
The canonical SMILES for 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynyl N-tert-butylcarbamate is Cc1nc(N)nc(Cl)c1C#CCOC(=O)NC(C)(C)C.
What is the InChIKey of 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynyl N-tert-butylcarbamate?
The InChIKey is VMMXYKVXJHEAGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN4O2/c1-8-9(10(14)17-11(15)16-8)6-5-7-20-12(19)18-13(2,3)4/h7H2,1-4H3,(H,18,19)(H2,15,16,17).
What are the key properties of 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynyl N-tert-butylcarbamate?
3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynyl N-tert-butylcarbamate has a molecular weight of 296.76 g/mol, XLogP of 1.90, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-4-chloro-6-methylpyrimidin-5-yl)prop-2-ynyl N-tert-butylcarbamate is sourced from PubChem (CID 142791381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).