C17H12F2N8O2 — CID 142791413
2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-6-[(1R)-1-(5-fluoropyrimidin-2-yl)ethyl]-5-nitropyrimidin-4-amine (PubChem CID 142791413) has the molecular formula C17H12F2N8O2 and a molecular weight of 398.33 g/mol. Its IUPAC name is 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-6-[(1R)-1-(5-fluoropyrimidin-2-yl)ethyl]-5-nitropyrimidin-4-amine.
| Compound Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-6-[(1R)-1-(5-fluoropyrimidin-2-yl)ethyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 142791413 |
| Molecular Formula | C17H12F2N8O2 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-6-[(1R)-1-(5-fluoropyrimidin-2-yl)ethyl]-5-nitropyrimidin-4-amine |
| SMILES | C[C@@H](c1ncc(F)cn1)c1nc(-c2cnc3ccc(F)cn23)nc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12F2N8O2/c1-8(16-22-4-10(19)5-23-16)13-14(27(28)29)15(20)25-17(24-13)11-6-21-12-3-2-9(18)7-26(11)12/h2-8H,1H3,(H2,20,24,25)/t8-/m1/s1 |
| InChIKey | MRCKHXPRHQTIKZ-MRVPVSSYSA-N |
| XLogP | 2.50 |
| TPSA | 138.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|