C20H16FN7O2 — CID 142791424
3-[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-yl]-5,6,7,8-tetrahydroquinolin-5-amine (PubChem CID 142791424) has the molecular formula C20H16FN7O2 and a molecular weight of 405.39 g/mol. Its IUPAC name is 3-[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-yl]-5,6,7,8-tetrahydroquinolin-5-amine.
| Compound Name | 3-[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-yl]-5,6,7,8-tetrahydroquinolin-5-amine |
|---|---|
| PubChem CID | 142791424 |
| Molecular Formula | C20H16FN7O2 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 3-[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-yl]-5,6,7,8-tetrahydroquinolin-5-amine |
| SMILES | NC1CCCc2ncc(-c3nc(-c4cnc5ccc(F)cn45)ncc3[N+](=O)[O-])cc21 |
| InChI | InChI=1S/C20H16FN7O2/c21-12-4-5-18-24-9-17(27(18)10-12)20-25-8-16(28(29)30)19(26-20)11-6-13-14(22)2-1-3-15(13)23-7-11/h4-10,14H,1-3,22H2 |
| InChIKey | ZFFIJLUEEXNXLF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|