C8H9F5N2O — CID 142791594
4-methoxy-1-(3,3,4,4,4-pentafluorobutyl)pyrazole (PubChem CID 142791594) has the molecular formula C8H9F5N2O and a molecular weight of 244.16 g/mol. Its IUPAC name is 4-methoxy-1-(3,3,4,4,4-pentafluorobutyl)pyrazole.
| Compound Name | 4-methoxy-1-(3,3,4,4,4-pentafluorobutyl)pyrazole |
|---|---|
| PubChem CID | 142791594 |
| Molecular Formula | C8H9F5N2O |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 4-methoxy-1-(3,3,4,4,4-pentafluorobutyl)pyrazole |
| SMILES | COc1cnn(CCC(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C8H9F5N2O/c1-16-6-4-14-15(5-6)3-2-7(9,10)8(11,12)13/h4-5H,2-3H2,1H3 |
| InChIKey | ASCCRKBCGXXMQI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|