About 1-(3-cyanophenyl)propyl (2S)-2-(methylamino)propanoate
1-(3-cyanophenyl)propyl (2S)-2-(methylamino)propanoate (PubChem CID 142791612) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-(3-cyanophenyl)propyl (2S)-2-(methylamino)propanoate.
Molecular Properties
| Compound Name | 1-(3-cyanophenyl)propyl (2S)-2-(methylamino)propanoate |
| PubChem CID | 142791612 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-(3-cyanophenyl)propyl (2S)-2-(methylamino)propanoate |
| SMILES | CCC(OC(=O)[C@H](C)NC)c1cccc(C#N)c1 |
| InChI | InChI=1S/C14H18N2O2/c1-4-13(18-14(17)10(2)16-3)12-7-5-6-11(8-12)9-15/h5-8,10,13,16H,4H2,1-3H3/t10-,13?/m0/s1 |
| InChIKey | JONGWEBTQGKUOF-NKUHCKNESA-N |
| XLogP | 2.16 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-cyanophenyl)propyl (2S)-2-(methylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-cyanophenyl)propyl (2S)-2-(methylamino)propanoate?
The IUPAC name of 1-(3-cyanophenyl)propyl (2S)-2-(methylamino)propanoate (CID 142791612) is 1-(3-cyanophenyl)propyl (2S)-2-(methylamino)propanoate.
What is the SMILES notation for 1-(3-cyanophenyl)propyl (2S)-2-(methylamino)propanoate?
The canonical SMILES for 1-(3-cyanophenyl)propyl (2S)-2-(methylamino)propanoate is CCC(OC(=O)[C@H](C)NC)c1cccc(C#N)c1.
What is the InChIKey of 1-(3-cyanophenyl)propyl (2S)-2-(methylamino)propanoate?
The InChIKey is JONGWEBTQGKUOF-NKUHCKNESA-N. The full InChI is InChI=1S/C14H18N2O2/c1-4-13(18-14(17)10(2)16-3)12-7-5-6-11(8-12)9-15/h5-8,10,13,16H,4H2,1-3H3/t10-,13?/m0/s1.
What are the key properties of 1-(3-cyanophenyl)propyl (2S)-2-(methylamino)propanoate?
1-(3-cyanophenyl)propyl (2S)-2-(methylamino)propanoate has a molecular weight of 246.31 g/mol, XLogP of 2.16, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-cyanophenyl)propyl (2S)-2-(methylamino)propanoate is sourced from PubChem (CID 142791612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).