C20H19BrN4O — CID 142791812
2-[bis(pyridin-3-ylmethyl)amino]-2-(4-bromophenyl)acetamide (PubChem CID 142791812) has the molecular formula C20H19BrN4O and a molecular weight of 411.30 g/mol. Its IUPAC name is 2-[bis(pyridin-3-ylmethyl)amino]-2-(4-bromophenyl)acetamide.
| Compound Name | 2-[bis(pyridin-3-ylmethyl)amino]-2-(4-bromophenyl)acetamide |
|---|---|
| PubChem CID | 142791812 |
| Molecular Formula | C20H19BrN4O |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 2-[bis(pyridin-3-ylmethyl)amino]-2-(4-bromophenyl)acetamide |
| SMILES | NC(=O)C(c1ccc(Br)cc1)N(Cc1cccnc1)Cc1cccnc1 |
| InChI | InChI=1S/C20H19BrN4O/c21-18-7-5-17(6-8-18)19(20(22)26)25(13-15-3-1-9-23-11-15)14-16-4-2-10-24-12-16/h1-12,19H,13-14H2,(H2,22,26) |
| InChIKey | JWYVKLHBLBFWRJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |