C22H22Cl2N4O — CID 142791977
2-(2,3-dichlorophenyl)-4-pyridin-3-yl-2-(2-pyridin-4-ylethylamino)butanamide (PubChem CID 142791977) has the molecular formula C22H22Cl2N4O and a molecular weight of 429.35 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-4-pyridin-3-yl-2-(2-pyridin-4-ylethylamino)butanamide.
| Compound Name | 2-(2,3-dichlorophenyl)-4-pyridin-3-yl-2-(2-pyridin-4-ylethylamino)butanamide |
|---|---|
| PubChem CID | 142791977 |
| Molecular Formula | C22H22Cl2N4O |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-4-pyridin-3-yl-2-(2-pyridin-4-ylethylamino)butanamide |
| SMILES | NC(=O)C(CCc1cccnc1)(NCCc1ccncc1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H22Cl2N4O/c23-19-5-1-4-18(20(19)24)22(21(25)29,10-6-17-3-2-11-27-15-17)28-14-9-16-7-12-26-13-8-16/h1-5,7-8,11-13,15,28H,6,9-10,14H2,(H2,25,29) |
| InChIKey | MTROVGOLSPREHV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |