C24H34N4O — CID 142792323
2-(2-ethylphenyl)-2-(2-piperidin-4-ylethylamino)-4-pyridin-4-ylbutanamide (PubChem CID 142792323) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is 2-(2-ethylphenyl)-2-(2-piperidin-4-ylethylamino)-4-pyridin-4-ylbutanamide.
| Compound Name | 2-(2-ethylphenyl)-2-(2-piperidin-4-ylethylamino)-4-pyridin-4-ylbutanamide |
|---|---|
| PubChem CID | 142792323 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 2-(2-ethylphenyl)-2-(2-piperidin-4-ylethylamino)-4-pyridin-4-ylbutanamide |
| SMILES | CCc1ccccc1C(CCc1ccncc1)(NCCC1CCNCC1)C(N)=O |
| InChI | InChI=1S/C24H34N4O/c1-2-21-5-3-4-6-22(21)24(23(25)29,13-7-19-8-14-26-15-9-19)28-18-12-20-10-16-27-17-11-20/h3-6,8-9,14-15,20,27-28H,2,7,10-13,16-18H2,1H3,(H2,25,29) |
| InChIKey | APCWLXJLRHCDIK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |