C22H24N4O2 — CID 142792386
2-(2-ethoxyphenyl)-3-pyridin-4-yl-2-(pyridin-3-ylmethylamino)propanamide (PubChem CID 142792386) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)-3-pyridin-4-yl-2-(pyridin-3-ylmethylamino)propanamide.
| Compound Name | 2-(2-ethoxyphenyl)-3-pyridin-4-yl-2-(pyridin-3-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 142792386 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-(2-ethoxyphenyl)-3-pyridin-4-yl-2-(pyridin-3-ylmethylamino)propanamide |
| SMILES | CCOc1ccccc1C(Cc1ccncc1)(NCc1cccnc1)C(N)=O |
| InChI | InChI=1S/C22H24N4O2/c1-2-28-20-8-4-3-7-19(20)22(21(23)27,14-17-9-12-24-13-10-17)26-16-18-6-5-11-25-15-18/h3-13,15,26H,2,14,16H2,1H3,(H2,23,27) |
| InChIKey | ICAWOYSXEUTUJQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |