C26H26N4O — CID 142792470
2-naphthalen-2-yl-4-pyridin-4-yl-2-(2-pyridin-4-ylethylamino)butanamide (PubChem CID 142792470) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-naphthalen-2-yl-4-pyridin-4-yl-2-(2-pyridin-4-ylethylamino)butanamide.
| Compound Name | 2-naphthalen-2-yl-4-pyridin-4-yl-2-(2-pyridin-4-ylethylamino)butanamide |
|---|---|
| PubChem CID | 142792470 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-naphthalen-2-yl-4-pyridin-4-yl-2-(2-pyridin-4-ylethylamino)butanamide |
| SMILES | NC(=O)C(CCc1ccncc1)(NCCc1ccncc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H26N4O/c27-25(31)26(13-7-20-8-14-28-15-9-20,30-18-12-21-10-16-29-17-11-21)24-6-5-22-3-1-2-4-23(22)19-24/h1-6,8-11,14-17,19,30H,7,12-13,18H2,(H2,27,31) |
| InChIKey | VVVLEZMBJOUUJS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |