C12H15Br — CID 142794167
1-bromo-3-(2-propylcyclopropyl)benzene (PubChem CID 142794167) has the molecular formula C12H15Br and a molecular weight of 239.16 g/mol. Its IUPAC name is 1-bromo-3-(2-propylcyclopropyl)benzene.
| Compound Name | 1-bromo-3-(2-propylcyclopropyl)benzene |
|---|---|
| PubChem CID | 142794167 |
| Molecular Formula | C12H15Br |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 1-bromo-3-(2-propylcyclopropyl)benzene |
| SMILES | CCCC1CC1c1cccc(Br)c1 |
| InChI | InChI=1S/C12H15Br/c1-2-4-9-8-12(9)10-5-3-6-11(13)7-10/h3,5-7,9,12H,2,4,8H2,1H3 |
| InChIKey | SHJARSFGWMZQKY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |