About 3-(1,2,5-oxadiazol-3-yl)benzamide
3-(1,2,5-oxadiazol-3-yl)benzamide (PubChem CID 142794316) has the molecular formula C9H7N3O2
and a molecular weight of 189.17 g/mol. Its IUPAC name is 3-(1,2,5-oxadiazol-3-yl)benzamide.
Molecular Properties
| Compound Name | 3-(1,2,5-oxadiazol-3-yl)benzamide |
| PubChem CID | 142794316 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 3-(1,2,5-oxadiazol-3-yl)benzamide |
| SMILES | NC(=O)c1cccc(-c2cnon2)c1 |
| InChI | InChI=1S/C9H7N3O2/c10-9(13)7-3-1-2-6(4-7)8-5-11-14-12-8/h1-5H,(H2,10,13) |
| InChIKey | WZAXHLOAOIMGCU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,2,5-oxadiazol-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,5-oxadiazol-3-yl)benzamide?
The IUPAC name of 3-(1,2,5-oxadiazol-3-yl)benzamide (CID 142794316) is 3-(1,2,5-oxadiazol-3-yl)benzamide.
What is the SMILES notation for 3-(1,2,5-oxadiazol-3-yl)benzamide?
The canonical SMILES for 3-(1,2,5-oxadiazol-3-yl)benzamide is NC(=O)c1cccc(-c2cnon2)c1.
What is the InChIKey of 3-(1,2,5-oxadiazol-3-yl)benzamide?
The InChIKey is WZAXHLOAOIMGCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2/c10-9(13)7-3-1-2-6(4-7)8-5-11-14-12-8/h1-5H,(H2,10,13).
What are the key properties of 3-(1,2,5-oxadiazol-3-yl)benzamide?
3-(1,2,5-oxadiazol-3-yl)benzamide has a molecular weight of 189.17 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,5-oxadiazol-3-yl)benzamide is sourced from PubChem (CID 142794316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).