C22H21ClN2O4S — CID 14279446
5-[[4-[2-[5-(3-chlorophenyl)-2-oxo-1,3-oxazolidin-3-yl]propyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 14279446) has the molecular formula C22H21ClN2O4S and a molecular weight of 444.94 g/mol. Its IUPAC name is 5-[[4-[2-[5-(3-chlorophenyl)-2-oxo-1,3-oxazolidin-3-yl]propyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[5-(3-chlorophenyl)-2-oxo-1,3-oxazolidin-3-yl]propyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 14279446 |
| Molecular Formula | C22H21ClN2O4S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 5-[[4-[2-[5-(3-chlorophenyl)-2-oxo-1,3-oxazolidin-3-yl]propyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(Cc1ccc(CC2SC(=O)NC2=O)cc1)N1CC(c2cccc(Cl)c2)OC1=O |
| InChI | InChI=1S/C22H21ClN2O4S/c1-13(25-12-18(29-22(25)28)16-3-2-4-17(23)11-16)9-14-5-7-15(8-6-14)10-19-20(26)24-21(27)30-19/h2-8,11,13,18-19H,9-10,12H2,1H3,(H,24,26,27) |
| InChIKey | BGOVHLOSVHFDGT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|