C12H20BN3O3 — CID 142794515
[2-[4-(dimethylamino)piperidin-1-yl]-4-pyridinyl]oxyboronic acid (PubChem CID 142794515) has the molecular formula C12H20BN3O3 and a molecular weight of 265.12 g/mol. Its IUPAC name is [2-[4-(dimethylamino)piperidin-1-yl]-4-pyridinyl]oxyboronic acid.
| Compound Name | [2-[4-(dimethylamino)piperidin-1-yl]-4-pyridinyl]oxyboronic acid |
|---|---|
| PubChem CID | 142794515 |
| Molecular Formula | C12H20BN3O3 |
| Molecular Weight | 265.12 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | [2-[4-(dimethylamino)piperidin-1-yl]-4-pyridinyl]oxyboronic acid |
| SMILES | CN(C)C1CCN(c2cc(OB(O)O)ccn2)CC1 |
| InChI | InChI=1S/C12H20BN3O3/c1-15(2)10-4-7-16(8-5-10)12-9-11(3-6-14-12)19-13(17)18/h3,6,9-10,17-18H,4-5,7-8H2,1-2H3 |
| InChIKey | XXBDPJJSXSYZOF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 69.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.12 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|